C12H7ClF2N2O2 — CID 104838755
3-chloro-N-(3,5-difluorophenyl)-2-nitroaniline (PubChem CID 104838755) has the molecular formula C12H7ClF2N2O2 and a molecular weight of 284.65 g/mol. Its IUPAC name is 3-chloro-N-(3,5-difluorophenyl)-2-nitroaniline.
| Compound Name | 3-chloro-N-(3,5-difluorophenyl)-2-nitroaniline |
|---|---|
| PubChem CID | 104838755 |
| Molecular Formula | C12H7ClF2N2O2 |
| Molecular Weight | 284.65 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 3-chloro-N-(3,5-difluorophenyl)-2-nitroaniline |
| SMILES | O=[N+]([O-])c1c(Cl)cccc1Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H7ClF2N2O2/c13-10-2-1-3-11(12(10)17(18)19)16-9-5-7(14)4-8(15)6-9/h1-6,16H |
| InChIKey | RCIDONYRLSQJDX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|