C11H15ClN2 — CID 104839702
8-chloro-3-ethyl-3-methyl-2,4-dihydro-1H-quinoxaline (PubChem CID 104839702) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is 8-chloro-3-ethyl-3-methyl-2,4-dihydro-1H-quinoxaline.
| Compound Name | 8-chloro-3-ethyl-3-methyl-2,4-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 104839702 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 8-chloro-3-ethyl-3-methyl-2,4-dihydro-1H-quinoxaline |
| SMILES | CCC1(C)CNc2c(Cl)cccc2N1 |
| InChI | InChI=1S/C11H15ClN2/c1-3-11(2)7-13-10-8(12)5-4-6-9(10)14-11/h4-6,13-14H,3,7H2,1-2H3 |
| InChIKey | YQECIDQGUFZQNT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |