C11H12IN3O — CID 104840074
N-[1-(furan-2-yl)propan-2-yl]-5-iodopyrimidin-2-amine (PubChem CID 104840074) has the molecular formula C11H12IN3O and a molecular weight of 329.14 g/mol. Its IUPAC name is N-[1-(furan-2-yl)propan-2-yl]-5-iodopyrimidin-2-amine.
| Compound Name | N-[1-(furan-2-yl)propan-2-yl]-5-iodopyrimidin-2-amine |
|---|---|
| PubChem CID | 104840074 |
| Molecular Formula | C11H12IN3O |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | N-[1-(furan-2-yl)propan-2-yl]-5-iodopyrimidin-2-amine |
| SMILES | CC(Cc1ccco1)Nc1ncc(I)cn1 |
| InChI | InChI=1S/C11H12IN3O/c1-8(5-10-3-2-4-16-10)15-11-13-6-9(12)7-14-11/h2-4,6-8H,5H2,1H3,(H,13,14,15) |
| InChIKey | DWNQFDMWYCIQRN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|