C11H12IN3S — CID 104840172
N-[(5-ethylthiophen-2-yl)methyl]-5-iodopyrimidin-2-amine (PubChem CID 104840172) has the molecular formula C11H12IN3S and a molecular weight of 345.21 g/mol. Its IUPAC name is N-[(5-ethylthiophen-2-yl)methyl]-5-iodopyrimidin-2-amine.
| Compound Name | N-[(5-ethylthiophen-2-yl)methyl]-5-iodopyrimidin-2-amine |
|---|---|
| PubChem CID | 104840172 |
| Molecular Formula | C11H12IN3S |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | N-[(5-ethylthiophen-2-yl)methyl]-5-iodopyrimidin-2-amine |
| SMILES | CCc1ccc(CNc2ncc(I)cn2)s1 |
| InChI | InChI=1S/C11H12IN3S/c1-2-9-3-4-10(16-9)7-15-11-13-5-8(12)6-14-11/h3-6H,2,7H2,1H3,(H,13,14,15) |
| InChIKey | BXKRYBYXYPVDSQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|