About 3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol
3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol (PubChem CID 104840298) has the molecular formula C11H25N3O
and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol.
Molecular Properties
| Compound Name | 3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol |
| PubChem CID | 104840298 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol |
| SMILES | CCC(N)C(CO)N1CCCN(C)CC1 |
| InChI | InChI=1S/C11H25N3O/c1-3-10(12)11(9-15)14-6-4-5-13(2)7-8-14/h10-11,15H,3-9,12H2,1-2H3 |
| InChIKey | NDXSCQKWDJMOKH-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol?
The IUPAC name of 3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol (CID 104840298) is 3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol.
What is the SMILES notation for 3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol?
The canonical SMILES for 3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol is CCC(N)C(CO)N1CCCN(C)CC1.
What is the InChIKey of 3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol?
The InChIKey is NDXSCQKWDJMOKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3O/c1-3-10(12)11(9-15)14-6-4-5-13(2)7-8-14/h10-11,15H,3-9,12H2,1-2H3.
What are the key properties of 3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol?
3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol has a molecular weight of 215.34 g/mol, XLogP of -0.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(4-methyl-1,4-diazepan-1-yl)pentan-1-ol is sourced from PubChem (CID 104840298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).