C11H22N4O — CID 104840535
3-amino-2-(3,5-diethyl-1,2,4-triazol-1-yl)pentan-1-ol (PubChem CID 104840535) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-amino-2-(3,5-diethyl-1,2,4-triazol-1-yl)pentan-1-ol.
| Compound Name | 3-amino-2-(3,5-diethyl-1,2,4-triazol-1-yl)pentan-1-ol |
|---|---|
| PubChem CID | 104840535 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 3-amino-2-(3,5-diethyl-1,2,4-triazol-1-yl)pentan-1-ol |
| SMILES | CCc1nc(CC)n(C(CO)C(N)CC)n1 |
| InChI | InChI=1S/C11H22N4O/c1-4-8(12)9(7-16)15-11(6-3)13-10(5-2)14-15/h8-9,16H,4-7,12H2,1-3H3 |
| InChIKey | FPGPSWBXRMGSCX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |