C30H40O14 — CID 10484056
[(1R,2R,3S,4R,5R,6S,8S,10R,11R,12R,15S)-3,4,6,11-tetraacetyloxy-2,8-dihydroxy-1,15-dimethyl-9-methylidene-14-oxo-16-oxatetracyclo[10.5.0.02,15.05,10]heptadecan-5-yl]methyl acetate (PubChem CID 10484056) has the molecular formula C30H40O14 and a molecular weight of 624.64 g/mol. Its IUPAC name is [(1R,2R,3S,4R,5R,6S,8S,10R,11R,12R,15S)-3,4,6,11-tetraacetyloxy-2,8-dihydroxy-1,15-dimethyl-9-methylidene-14-oxo-16-oxatetracyclo[10.5.0.02,15.05,10]heptadecan-5-yl]methyl acetate.
| Compound Name | [(1R,2R,3S,4R,5R,6S,8S,10R,11R,12R,15S)-3,4,6,11-tetraacetyloxy-2,8-dihydroxy-1,15-dimethyl-9-methylidene-14-oxo-16-oxatetracyclo[10.5.0.02,15.05,10]heptadecan-5-yl]methyl acetate |
|---|---|
| PubChem CID | 10484056 |
| Molecular Formula | C30H40O14 |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | [(1R,2R,3S,4R,5R,6S,8S,10R,11R,12R,15S)-3,4,6,11-tetraacetyloxy-2,8-dihydroxy-1,15-dimethyl-9-methylidene-14-oxo-16-oxatetracyclo[10.5.0.02,15.05,10]heptadecan-5-yl]methyl acetate |
| SMILES | C=C1[C@@H](O)C[C@H](OC(C)=O)[C@@]2(COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@]3(O)[C@@]4(C)CO[C@]3(C)C(=O)C[C@H]4[C@@H](OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C30H40O14/c1-13-20(36)10-22(41-15(3)32)29(12-39-14(2)31)23(13)24(42-16(4)33)19-9-21(37)28(8)30(38,27(19,7)11-40-28)26(44-18(6)35)25(29)43-17(5)34/h19-20,22-26,36,38H,1,9-12H2,2-8H3/t19-,20-,22-,23-,24+,25-,26-,27-,28+,29+,30-/m0/s1 |
| InChIKey | NLAYBBWKEUNLKD-LQCJOEJLSA-N |
| XLogP | 0.33 |
| TPSA | 198.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|