C8H15F4NO2 — CID 104840600
3-amino-2-(2,2,3,3-tetrafluoropropoxy)pentan-1-ol (PubChem CID 104840600) has the molecular formula C8H15F4NO2 and a molecular weight of 233.20 g/mol. Its IUPAC name is 3-amino-2-(2,2,3,3-tetrafluoropropoxy)pentan-1-ol.
| Compound Name | 3-amino-2-(2,2,3,3-tetrafluoropropoxy)pentan-1-ol |
|---|---|
| PubChem CID | 104840600 |
| Molecular Formula | C8H15F4NO2 |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3-amino-2-(2,2,3,3-tetrafluoropropoxy)pentan-1-ol |
| SMILES | CCC(N)C(CO)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H15F4NO2/c1-2-5(13)6(3-14)15-4-8(11,12)7(9)10/h5-7,14H,2-4,13H2,1H3 |
| InChIKey | HIXYTAJBPPKUBI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|