C39H55N5O2 — CID 10484082
2-[(3S)-1-[7-[ethyl-[1-[(4-methoxy-3-pyridinyl)methyl]piperidin-4-yl]amino]heptyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 10484082) has the molecular formula C39H55N5O2 and a molecular weight of 625.90 g/mol. Its IUPAC name is 2-[(3S)-1-[7-[ethyl-[1-[(4-methoxy-3-pyridinyl)methyl]piperidin-4-yl]amino]heptyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[(3S)-1-[7-[ethyl-[1-[(4-methoxy-3-pyridinyl)methyl]piperidin-4-yl]amino]heptyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 10484082 |
| Molecular Formula | C39H55N5O2 |
| Molecular Weight | 625.90 g/mol |
| Exact Mass | 625.44 |
| IUPAC Name | 2-[(3S)-1-[7-[ethyl-[1-[(4-methoxy-3-pyridinyl)methyl]piperidin-4-yl]amino]heptyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | CCN(CCCCCCCN1CC[C@@H](C(C(N)=O)(c2ccccc2)c2ccccc2)C1)C1CCN(Cc2cnccc2OC)CC1 |
| InChI | InChI=1S/C39H55N5O2/c1-3-44(36-21-27-43(28-22-36)30-32-29-41-23-19-37(32)46-2)25-14-6-4-5-13-24-42-26-20-35(31-42)39(38(40)45,33-15-9-7-10-16-33)34-17-11-8-12-18-34/h7-12,15-19,23,29,35-36H,3-6,13-14,20-22,24-28,30-31H2,1-2H3,(H2,40,45)/t35-/m1/s1 |
| InChIKey | SNYVJQHKZFBGLU-PGUFJCEWSA-N |
| XLogP | 6.12 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.90 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|