C12H9Cl2NO3 — CID 104842536
2-(2,3-dichlorophenyl)-4-ethyl-1,3-oxazole-5-carboxylic acid (PubChem CID 104842536) has the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-4-ethyl-1,3-oxazole-5-carboxylic acid.
| Compound Name | 2-(2,3-dichlorophenyl)-4-ethyl-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 104842536 |
| Molecular Formula | C12H9Cl2NO3 |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-4-ethyl-1,3-oxazole-5-carboxylic acid |
| SMILES | CCc1nc(-c2cccc(Cl)c2Cl)oc1C(=O)O |
| InChI | InChI=1S/C12H9Cl2NO3/c1-2-8-10(12(16)17)18-11(15-8)6-4-3-5-7(13)9(6)14/h3-5H,2H2,1H3,(H,16,17) |
| InChIKey | NGTDINGADPCOBZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |