C13H19NO3 — CID 104842750
ethyl 2-cyclopentyl-4-ethyl-1,3-oxazole-5-carboxylate (PubChem CID 104842750) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is ethyl 2-cyclopentyl-4-ethyl-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 2-cyclopentyl-4-ethyl-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 104842750 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | ethyl 2-cyclopentyl-4-ethyl-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1oc(C2CCCC2)nc1CC |
| InChI | InChI=1S/C13H19NO3/c1-3-10-11(13(15)16-4-2)17-12(14-10)9-7-5-6-8-9/h9H,3-8H2,1-2H3 |
| InChIKey | OCAKXTRRXVKMCK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |