C14H17Cl2NO — CID 104842849
N-[(6,7-dichloro-3-ethyl-1-benzofuran-2-yl)methyl]propan-1-amine (PubChem CID 104842849) has the molecular formula C14H17Cl2NO and a molecular weight of 286.20 g/mol. Its IUPAC name is N-[(6,7-dichloro-3-ethyl-1-benzofuran-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(6,7-dichloro-3-ethyl-1-benzofuran-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 104842849 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-[(6,7-dichloro-3-ethyl-1-benzofuran-2-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1oc2c(Cl)c(Cl)ccc2c1CC |
| InChI | InChI=1S/C14H17Cl2NO/c1-3-7-17-8-12-9(4-2)10-5-6-11(15)13(16)14(10)18-12/h5-6,17H,3-4,7-8H2,1-2H3 |
| InChIKey | DHVVUFWVEBCHTR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|