About (3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine
(3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine (PubChem CID 104843312) has the molecular formula C13H17NS
and a molecular weight of 219.35 g/mol. Its IUPAC name is (3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine.
Molecular Properties
| Compound Name | (3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine |
| PubChem CID | 104843312 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | (3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine |
| SMILES | CCc1c(CN)sc2c(C)cc(C)cc12 |
| InChI | InChI=1S/C13H17NS/c1-4-10-11-6-8(2)5-9(3)13(11)15-12(10)7-14/h5-6H,4,7,14H2,1-3H3 |
| InChIKey | BTWQRSLLAZGVBU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine?
The IUPAC name of (3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine (CID 104843312) is (3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine.
What is the SMILES notation for (3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine?
The canonical SMILES for (3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine is CCc1c(CN)sc2c(C)cc(C)cc12.
What is the InChIKey of (3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine?
The InChIKey is BTWQRSLLAZGVBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NS/c1-4-10-11-6-8(2)5-9(3)13(11)15-12(10)7-14/h5-6H,4,7,14H2,1-3H3.
What are the key properties of (3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine?
(3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine has a molecular weight of 219.35 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-5,7-dimethyl-1-benzothiophen-2-yl)methanamine is sourced from PubChem (CID 104843312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).