C11H13IN4S — CID 104844066
N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-5-iodopyrimidin-2-amine (PubChem CID 104844066) has the molecular formula C11H13IN4S and a molecular weight of 360.22 g/mol. Its IUPAC name is N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-5-iodopyrimidin-2-amine.
| Compound Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-5-iodopyrimidin-2-amine |
|---|---|
| PubChem CID | 104844066 |
| Molecular Formula | C11H13IN4S |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | N-[1-(5-ethyl-1,3-thiazol-2-yl)ethyl]-5-iodopyrimidin-2-amine |
| SMILES | CCc1cnc(C(C)Nc2ncc(I)cn2)s1 |
| InChI | InChI=1S/C11H13IN4S/c1-3-9-6-13-10(17-9)7(2)16-11-14-4-8(12)5-15-11/h4-7H,3H2,1-2H3,(H,14,15,16) |
| InChIKey | BPAQZZGFJOFSJW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|