C36H62O7Si2 — CID 10484525
6-[(3R,4R,5E,7S,8S,9E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,9-trimethyl-2-oxoundeca-5,9-dienyl]-4-(oxan-2-yloxy)pyran-2-one (PubChem CID 10484525) has the molecular formula C36H62O7Si2 and a molecular weight of 663.06 g/mol. Its IUPAC name is 6-[(3R,4R,5E,7S,8S,9E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,9-trimethyl-2-oxoundeca-5,9-dienyl]-4-(oxan-2-yloxy)pyran-2-one.
| Compound Name | 6-[(3R,4R,5E,7S,8S,9E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,9-trimethyl-2-oxoundeca-5,9-dienyl]-4-(oxan-2-yloxy)pyran-2-one |
|---|---|
| PubChem CID | 10484525 |
| Molecular Formula | C36H62O7Si2 |
| Molecular Weight | 663.06 g/mol |
| Exact Mass | 662.40 |
| IUPAC Name | 6-[(3R,4R,5E,7S,8S,9E)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,9-trimethyl-2-oxoundeca-5,9-dienyl]-4-(oxan-2-yloxy)pyran-2-one |
| SMILES | C/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)Cc1cc(OC2CCCCO2)cc(=O)o1 |
| InChI | InChI=1S/C36H62O7Si2/c1-15-25(2)34(43-45(13,14)36(8,9)10)26(3)19-20-31(42-44(11,12)35(5,6)7)27(4)30(37)23-28-22-29(24-32(38)40-28)41-33-18-16-17-21-39-33/h15,19-20,22,24,26-27,31,33-34H,16-18,21,23H2,1-14H3/b20-19+,25-15+/t26-,27-,31+,33?,34+/m0/s1 |
| InChIKey | UTCIPCYMQVRZDQ-VNGZYYJZSA-N |
| XLogP | 9.23 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.06 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|