C18H22BrNO — CID 104846487
2-(3-bromo-2-methyl-3-phenylpropyl)-4-methoxy-3,5-dimethylpyridine (PubChem CID 104846487) has the molecular formula C18H22BrNO and a molecular weight of 348.28 g/mol. Its IUPAC name is 2-(3-bromo-2-methyl-3-phenylpropyl)-4-methoxy-3,5-dimethylpyridine.
| Compound Name | 2-(3-bromo-2-methyl-3-phenylpropyl)-4-methoxy-3,5-dimethylpyridine |
|---|---|
| PubChem CID | 104846487 |
| Molecular Formula | C18H22BrNO |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-(3-bromo-2-methyl-3-phenylpropyl)-4-methoxy-3,5-dimethylpyridine |
| SMILES | COc1c(C)cnc(CC(C)C(Br)c2ccccc2)c1C |
| InChI | InChI=1S/C18H22BrNO/c1-12(17(19)15-8-6-5-7-9-15)10-16-14(3)18(21-4)13(2)11-20-16/h5-9,11-12,17H,10H2,1-4H3 |
| InChIKey | WGQRZQQDOKWGAI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|