About 2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine
2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine (PubChem CID 104846807) has the molecular formula C14H17N3O
and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine |
| PubChem CID | 104846807 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine |
| SMILES | CNc1nc(COC)nc(-c2ccccc2)c1C |
| InChI | InChI=1S/C14H17N3O/c1-10-13(11-7-5-4-6-8-11)16-12(9-18-3)17-14(10)15-2/h4-8H,9H2,1-3H3,(H,15,16,17) |
| InChIKey | NHELIDUAYMXOIC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine?
The IUPAC name of 2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine (CID 104846807) is 2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine.
What is the SMILES notation for 2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine?
The canonical SMILES for 2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine is CNc1nc(COC)nc(-c2ccccc2)c1C.
What is the InChIKey of 2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine?
The InChIKey is NHELIDUAYMXOIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O/c1-10-13(11-7-5-4-6-8-11)16-12(9-18-3)17-14(10)15-2/h4-8H,9H2,1-3H3,(H,15,16,17).
What are the key properties of 2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine?
2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine has a molecular weight of 243.31 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-N,5-dimethyl-6-phenylpyrimidin-4-amine is sourced from PubChem (CID 104846807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).