C16H15N3S — CID 104846927
5-methyl-2-(3-methylthiophen-2-yl)-6-phenylpyrimidin-4-amine (PubChem CID 104846927) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 5-methyl-2-(3-methylthiophen-2-yl)-6-phenylpyrimidin-4-amine.
| Compound Name | 5-methyl-2-(3-methylthiophen-2-yl)-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 104846927 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5-methyl-2-(3-methylthiophen-2-yl)-6-phenylpyrimidin-4-amine |
| SMILES | Cc1ccsc1-c1nc(N)c(C)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H15N3S/c1-10-8-9-20-14(10)16-18-13(11(2)15(17)19-16)12-6-4-3-5-7-12/h3-9H,1-2H3,(H2,17,18,19) |
| InChIKey | ZHERBADQUTVXRQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |