C30H45ClN8O8 — CID 10484702
3,5-diamino-N-[N'-[4-[4-[2-[bis[[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]methyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide (PubChem CID 10484702) has the molecular formula C30H45ClN8O8 and a molecular weight of 681.19 g/mol. Its IUPAC name is 3,5-diamino-N-[N'-[4-[4-[2-[bis[[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]methyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-[N'-[4-[4-[2-[bis[[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]methyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 10484702 |
| Molecular Formula | C30H45ClN8O8 |
| Molecular Weight | 681.19 g/mol |
| Exact Mass | 680.30 |
| IUPAC Name | 3,5-diamino-N-[N'-[4-[4-[2-[bis[[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]methyl]amino]ethoxy]phenyl]butyl]carbamimidoyl]-6-chloropyrazine-2-carboxamide |
| SMILES | C[C@@H]1OC[C@@H](O)[C@H](CN(CCOc2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)C[C@@H]2O[C@H](C)OC[C@H]2O)O1 |
| InChI | InChI=1S/C30H45ClN8O8/c1-17-44-15-21(40)23(46-17)13-39(14-24-22(41)16-45-18(2)47-24)11-12-43-20-8-6-19(7-9-20)5-3-4-10-35-30(34)38-29(42)25-27(32)37-28(33)26(31)36-25/h6-9,17-18,21-24,40-41H,3-5,10-16H2,1-2H3,(H4,32,33,37)(H3,34,35,38,42)/t17-,18-,21-,22-,23+,24+/m1/s1 |
| InChIKey | HKYPVQJDEKCBCF-FVZFRCBOSA-N |
| XLogP | 0.29 |
| TPSA | 235.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|