C11H12N2O4S — CID 104849054
N-(4-cyano-2-methoxyphenyl)-2-methylsulfonylacetamide (PubChem CID 104849054) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is N-(4-cyano-2-methoxyphenyl)-2-methylsulfonylacetamide.
| Compound Name | N-(4-cyano-2-methoxyphenyl)-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 104849054 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | N-(4-cyano-2-methoxyphenyl)-2-methylsulfonylacetamide |
| SMILES | COc1cc(C#N)ccc1NC(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C11H12N2O4S/c1-17-10-5-8(6-12)3-4-9(10)13-11(14)7-18(2,15)16/h3-5H,7H2,1-2H3,(H,13,14) |
| InChIKey | TVASYVYIMVRQSC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |