C14H23BrN2O — CID 104851463
N'-[(3-bromo-5-methylphenyl)methyl]-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine (PubChem CID 104851463) has the molecular formula C14H23BrN2O and a molecular weight of 315.26 g/mol. Its IUPAC name is N'-[(3-bromo-5-methylphenyl)methyl]-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-[(3-bromo-5-methylphenyl)methyl]-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 104851463 |
| Molecular Formula | C14H23BrN2O |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N'-[(3-bromo-5-methylphenyl)methyl]-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| SMILES | COCCNCCN(C)Cc1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C14H23BrN2O/c1-12-8-13(10-14(15)9-12)11-17(2)6-4-16-5-7-18-3/h8-10,16H,4-7,11H2,1-3H3 |
| InChIKey | JUWDAPAOLVZHAB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|