C15H20BrNO2 — CID 104852419
3-bromo-N-ethyl-5-methyl-N-(oxolan-3-ylmethyl)benzamide (PubChem CID 104852419) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is 3-bromo-N-ethyl-5-methyl-N-(oxolan-3-ylmethyl)benzamide.
| Compound Name | 3-bromo-N-ethyl-5-methyl-N-(oxolan-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 104852419 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 3-bromo-N-ethyl-5-methyl-N-(oxolan-3-ylmethyl)benzamide |
| SMILES | CCN(CC1CCOC1)C(=O)c1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C15H20BrNO2/c1-3-17(9-12-4-5-19-10-12)15(18)13-6-11(2)7-14(16)8-13/h6-8,12H,3-5,9-10H2,1-2H3 |
| InChIKey | ABNDUPPFVHTDDX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |