C15H22BrNO — CID 104852960
3-bromo-5-methyl-N-(2,3,3-trimethylbutyl)benzamide (PubChem CID 104852960) has the molecular formula C15H22BrNO and a molecular weight of 312.25 g/mol. Its IUPAC name is 3-bromo-5-methyl-N-(2,3,3-trimethylbutyl)benzamide.
| Compound Name | 3-bromo-5-methyl-N-(2,3,3-trimethylbutyl)benzamide |
|---|---|
| PubChem CID | 104852960 |
| Molecular Formula | C15H22BrNO |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-bromo-5-methyl-N-(2,3,3-trimethylbutyl)benzamide |
| SMILES | Cc1cc(Br)cc(C(=O)NCC(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H22BrNO/c1-10-6-12(8-13(16)7-10)14(18)17-9-11(2)15(3,4)5/h6-8,11H,9H2,1-5H3,(H,17,18) |
| InChIKey | KRCNDEDDSCCPBC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |