C11H13N3 — CID 104853457
(1R)-1-azido-4-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 104853457) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is (1R)-1-azido-4-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R)-1-azido-4-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 104853457 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (1R)-1-azido-4-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC1CC[C@@H](N=[N+]=[N-])c2ccccc21 |
| InChI | InChI=1S/C11H13N3/c1-8-6-7-11(13-14-12)10-5-3-2-4-9(8)10/h2-5,8,11H,6-7H2,1H3/t8?,11-/m1/s1 |
| InChIKey | MKQSQALMKUQLCF-QHDYGNBISA-N |
| XLogP | 3.94 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|