C10H9F2NO — CID 104853689
3-(2,2-difluoroethoxy)-4-methylbenzonitrile (PubChem CID 104853689) has the molecular formula C10H9F2NO and a molecular weight of 197.18 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-4-methylbenzonitrile.
| Compound Name | 3-(2,2-difluoroethoxy)-4-methylbenzonitrile |
|---|---|
| PubChem CID | 104853689 |
| Molecular Formula | C10H9F2NO |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)cc1OCC(F)F |
| InChI | InChI=1S/C10H9F2NO/c1-7-2-3-8(5-13)4-9(7)14-6-10(11)12/h2-4,10H,6H2,1H3 |
| InChIKey | BFTSLMJIUBDJLI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |