C9H12F3N5O2 — CID 104854465
6-N-methyl-5-nitro-4-N-(4,4,4-trifluorobutan-2-yl)pyrimidine-4,6-diamine (PubChem CID 104854465) has the molecular formula C9H12F3N5O2 and a molecular weight of 279.22 g/mol. Its IUPAC name is 6-N-methyl-5-nitro-4-N-(4,4,4-trifluorobutan-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-methyl-5-nitro-4-N-(4,4,4-trifluorobutan-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 104854465 |
| Molecular Formula | C9H12F3N5O2 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 6-N-methyl-5-nitro-4-N-(4,4,4-trifluorobutan-2-yl)pyrimidine-4,6-diamine |
| SMILES | CNc1ncnc(NC(C)CC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12F3N5O2/c1-5(3-9(10,11)12)16-8-6(17(18)19)7(13-2)14-4-15-8/h4-5H,3H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | MHGAAKQSIHGOPQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|