About N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide
N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide (PubChem CID 104854784) has the molecular formula C7H10F3N3O2S
and a molecular weight of 257.24 g/mol. Its IUPAC name is N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide |
| PubChem CID | 104854784 |
| Molecular Formula | C7H10F3N3O2S |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide |
| SMILES | CC(CC(F)(F)F)NS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C7H10F3N3O2S/c1-5(2-7(8,9)10)13-16(14,15)6-3-11-12-4-6/h3-5,13H,2H2,1H3,(H,11,12) |
| InChIKey | RXVAPQGPJFEXIC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide (CID 104854784) is N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide is CC(CC(F)(F)F)NS(=O)(=O)c1cn[nH]c1.
What is the InChIKey of N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide?
The InChIKey is RXVAPQGPJFEXIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F3N3O2S/c1-5(2-7(8,9)10)13-16(14,15)6-3-11-12-4-6/h3-5,13H,2H2,1H3,(H,11,12).
What are the key properties of N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide?
N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide has a molecular weight of 257.24 g/mol, XLogP of 1.03, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4,4-trifluorobutan-2-yl)-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 104854784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).