C9H10F3N3O2 — CID 104854846
6-oxo-N-(4,4,4-trifluorobutan-2-yl)-1H-pyridazine-3-carboxamide (PubChem CID 104854846) has the molecular formula C9H10F3N3O2 and a molecular weight of 249.19 g/mol. Its IUPAC name is 6-oxo-N-(4,4,4-trifluorobutan-2-yl)-1H-pyridazine-3-carboxamide.
| Compound Name | 6-oxo-N-(4,4,4-trifluorobutan-2-yl)-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 104854846 |
| Molecular Formula | C9H10F3N3O2 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 6-oxo-N-(4,4,4-trifluorobutan-2-yl)-1H-pyridazine-3-carboxamide |
| SMILES | CC(CC(F)(F)F)NC(=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C9H10F3N3O2/c1-5(4-9(10,11)12)13-8(17)6-2-3-7(16)15-14-6/h2-3,5H,4H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | OEMINAORCQCGOA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |