About 5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide
5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide (PubChem CID 104854924) has the molecular formula C9H9BrF3NOS
and a molecular weight of 316.14 g/mol. Its IUPAC name is 5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide |
| PubChem CID | 104854924 |
| Molecular Formula | C9H9BrF3NOS |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 314.95 |
| IUPAC Name | 5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide |
| SMILES | CC(CC(F)(F)F)NC(=O)c1csc(Br)c1 |
| InChI | InChI=1S/C9H9BrF3NOS/c1-5(3-9(11,12)13)14-8(15)6-2-7(10)16-4-6/h2,4-5H,3H2,1H3,(H,14,15) |
| InChIKey | PNFPLGZDSNOERF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide?
The IUPAC name of 5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide (CID 104854924) is 5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide.
What is the SMILES notation for 5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide?
The canonical SMILES for 5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide is CC(CC(F)(F)F)NC(=O)c1csc(Br)c1.
What is the InChIKey of 5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide?
The InChIKey is PNFPLGZDSNOERF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrF3NOS/c1-5(3-9(11,12)13)14-8(15)6-2-7(10)16-4-6/h2,4-5H,3H2,1H3,(H,14,15).
What are the key properties of 5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide?
5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide has a molecular weight of 316.14 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide is sourced from PubChem (CID 104854924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).