C10H20N2O — CID 104855992
N'-cyclopropyl-N-[[(2S)-oxolan-2-yl]methyl]ethane-1,2-diamine (PubChem CID 104855992) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is N'-cyclopropyl-N-[[(2S)-oxolan-2-yl]methyl]ethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-N-[[(2S)-oxolan-2-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 104855992 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N'-cyclopropyl-N-[[(2S)-oxolan-2-yl]methyl]ethane-1,2-diamine |
| SMILES | C1CO[C@H](CNCCNC2CC2)C1 |
| InChI | InChI=1S/C10H20N2O/c1-2-10(13-7-1)8-11-5-6-12-9-3-4-9/h9-12H,1-8H2/t10-/m0/s1 |
| InChIKey | FLNAKQNGTYRCFL-JTQLQIEISA-N |
| XLogP | 0.51 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|