C12H26N2O — CID 104856051
N'-tert-butyl-N-[[(2R)-oxolan-2-yl]methyl]propane-1,3-diamine (PubChem CID 104856051) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is N'-tert-butyl-N-[[(2R)-oxolan-2-yl]methyl]propane-1,3-diamine.
| Compound Name | N'-tert-butyl-N-[[(2R)-oxolan-2-yl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 104856051 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N'-tert-butyl-N-[[(2R)-oxolan-2-yl]methyl]propane-1,3-diamine |
| SMILES | CC(C)(C)NCCCNC[C@H]1CCCO1 |
| InChI | InChI=1S/C12H26N2O/c1-12(2,3)14-8-5-7-13-10-11-6-4-9-15-11/h11,13-14H,4-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | PRBYAGLVHASRJJ-LLVKDONJSA-N |
| XLogP | 1.53 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|