C14H23F2NO2 — CID 104857234
N-(2,2-difluoro-3-hydroxypropyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide (PubChem CID 104857234) has the molecular formula C14H23F2NO2 and a molecular weight of 275.34 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 104857234 |
| Molecular Formula | C14H23F2NO2 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxamide |
| SMILES | O=C(NCC(F)(F)CO)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C14H23F2NO2/c15-14(16,9-18)8-17-13(19)12-6-5-10-3-1-2-4-11(10)7-12/h10-12,18H,1-9H2,(H,17,19) |
| InChIKey | HYTSBWRJVPNNAM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |