About (Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide
(Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide (PubChem CID 104857267) has the molecular formula C9H15F2NO2
and a molecular weight of 207.22 g/mol. Its IUPAC name is (Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide.
Molecular Properties
| Compound Name | (Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide |
| PubChem CID | 104857267 |
| Molecular Formula | C9H15F2NO2 |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | (Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide |
| SMILES | CC/C=C(/C)C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C9H15F2NO2/c1-3-4-7(2)8(14)12-5-9(10,11)6-13/h4,13H,3,5-6H2,1-2H3,(H,12,14)/b7-4- |
| InChIKey | KLMLVQLEGXIEEW-DAXSKMNVSA-N |
| XLogP | 1.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide?
The IUPAC name of (Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide (CID 104857267) is (Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide.
What is the SMILES notation for (Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide?
The canonical SMILES for (Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide is CC/C=C(/C)C(=O)NCC(F)(F)CO.
What is the InChIKey of (Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide?
The InChIKey is KLMLVQLEGXIEEW-DAXSKMNVSA-N. The full InChI is InChI=1S/C9H15F2NO2/c1-3-4-7(2)8(14)12-5-9(10,11)6-13/h4,13H,3,5-6H2,1-2H3,(H,12,14)/b7-4-.
What are the key properties of (Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide?
(Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide has a molecular weight of 207.22 g/mol, XLogP of 1.09, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(2,2-difluoro-3-hydroxypropyl)-2-methylpent-2-enamide is sourced from PubChem (CID 104857267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).