About 1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide
1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide (PubChem CID 104857417) has the molecular formula C12H17F2N3O3
and a molecular weight of 289.28 g/mol. Its IUPAC name is 1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide |
| PubChem CID | 104857417 |
| Molecular Formula | C12H17F2N3O3 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCCCn1nc(C(=O)NCC(F)(F)CO)ccc1=O |
| InChI | InChI=1S/C12H17F2N3O3/c1-2-3-6-17-10(19)5-4-9(16-17)11(20)15-7-12(13,14)8-18/h4-5,18H,2-3,6-8H2,1H3,(H,15,20) |
| InChIKey | VBBCGUBIUYURFJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide?
The IUPAC name of 1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide (CID 104857417) is 1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide.
What is the SMILES notation for 1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide?
The canonical SMILES for 1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide is CCCCn1nc(C(=O)NCC(F)(F)CO)ccc1=O.
What is the InChIKey of 1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide?
The InChIKey is VBBCGUBIUYURFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2N3O3/c1-2-3-6-17-10(19)5-4-9(16-17)11(20)15-7-12(13,14)8-18/h4-5,18H,2-3,6-8H2,1H3,(H,15,20).
What are the key properties of 1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide?
1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide has a molecular weight of 289.28 g/mol, XLogP of 0.40, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-N-(2,2-difluoro-3-hydroxypropyl)-6-oxopyridazine-3-carboxamide is sourced from PubChem (CID 104857417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).