C12H23F2NO — CID 104857515
2,2-difluoro-3-[(4-propan-2-ylcyclohexyl)amino]propan-1-ol (PubChem CID 104857515) has the molecular formula C12H23F2NO and a molecular weight of 235.32 g/mol. Its IUPAC name is 2,2-difluoro-3-[(4-propan-2-ylcyclohexyl)amino]propan-1-ol.
| Compound Name | 2,2-difluoro-3-[(4-propan-2-ylcyclohexyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 104857515 |
| Molecular Formula | C12H23F2NO |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2,2-difluoro-3-[(4-propan-2-ylcyclohexyl)amino]propan-1-ol |
| SMILES | CC(C)C1CCC(NCC(F)(F)CO)CC1 |
| InChI | InChI=1S/C12H23F2NO/c1-9(2)10-3-5-11(6-4-10)15-7-12(13,14)8-16/h9-11,15-16H,3-8H2,1-2H3 |
| InChIKey | IRMBFDCQVJLODJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |