C11H16F2N2O2S2 — CID 104857649
N-(2,2-difluoro-3-hydroxypropyl)-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide (PubChem CID 104857649) has the molecular formula C11H16F2N2O2S2 and a molecular weight of 310.39 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 104857649 |
| Molecular Formula | C11H16F2N2O2S2 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide |
| SMILES | Cc1nc(CSCCC(=O)NCC(F)(F)CO)cs1 |
| InChI | InChI=1S/C11H16F2N2O2S2/c1-8-15-9(5-19-8)4-18-3-2-10(17)14-6-11(12,13)7-16/h5,16H,2-4,6-7H2,1H3,(H,14,17) |
| InChIKey | MCUWYKZEGUDEKY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|