About 3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol
3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol (PubChem CID 104857655) has the molecular formula C10H11BrClF2NO
and a molecular weight of 314.56 g/mol. Its IUPAC name is 3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol.
Molecular Properties
| Compound Name | 3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol |
| PubChem CID | 104857655 |
| Molecular Formula | C10H11BrClF2NO |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | 3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol |
| SMILES | OCC(F)(F)CNCc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C10H11BrClF2NO/c11-8-2-1-7(9(12)3-8)4-15-5-10(13,14)6-16/h1-3,15-16H,4-6H2 |
| InChIKey | CRNZZRISTGYVED-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol?
The IUPAC name of 3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol (CID 104857655) is 3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol.
What is the SMILES notation for 3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol?
The canonical SMILES for 3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol is OCC(F)(F)CNCc1ccc(Br)cc1Cl.
What is the InChIKey of 3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol?
The InChIKey is CRNZZRISTGYVED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrClF2NO/c11-8-2-1-7(9(12)3-8)4-15-5-10(13,14)6-16/h1-3,15-16H,4-6H2.
What are the key properties of 3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol?
3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol has a molecular weight of 314.56 g/mol, XLogP of 2.82, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-bromo-2-chlorophenyl)methylamino]-2,2-difluoropropan-1-ol is sourced from PubChem (CID 104857655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).