C12H15F2NO2 — CID 104858311
N-(2,2-difluoro-3-hydroxypropyl)-2-(2-methylphenyl)acetamide (PubChem CID 104858311) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-2-(2-methylphenyl)acetamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 104858311 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-2-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1CC(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C12H15F2NO2/c1-9-4-2-3-5-10(9)6-11(17)15-7-12(13,14)8-16/h2-5,16H,6-8H2,1H3,(H,15,17) |
| InChIKey | SNAVBFOYNZZNAM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |