C9H8F2N4O3 — CID 104858403
2-[(2,2-difluoro-3-hydroxypropyl)amino]-3-nitropyridine-4-carbonitrile (PubChem CID 104858403) has the molecular formula C9H8F2N4O3 and a molecular weight of 258.18 g/mol. Its IUPAC name is 2-[(2,2-difluoro-3-hydroxypropyl)amino]-3-nitropyridine-4-carbonitrile.
| Compound Name | 2-[(2,2-difluoro-3-hydroxypropyl)amino]-3-nitropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 104858403 |
| Molecular Formula | C9H8F2N4O3 |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-[(2,2-difluoro-3-hydroxypropyl)amino]-3-nitropyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NCC(F)(F)CO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8F2N4O3/c10-9(11,5-16)4-14-8-7(15(17)18)6(3-12)1-2-13-8/h1-2,16H,4-5H2,(H,13,14) |
| InChIKey | JFZDFWPHEHSMTJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|