About methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate
methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate (PubChem CID 104858746) has the molecular formula C8H10F2N2O5S2
and a molecular weight of 316.31 g/mol. Its IUPAC name is methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 104858746 |
| Molecular Formula | C8H10F2N2O5S2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1ncsc1S(=O)(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C8H10F2N2O5S2/c1-17-6(14)5-7(18-4-11-5)19(15,16)12-2-8(9,10)3-13/h4,12-13H,2-3H2,1H3 |
| InChIKey | PHPGLZARUZQNQB-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate (CID 104858746) is methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate is COC(=O)c1ncsc1S(=O)(=O)NCC(F)(F)CO.
What is the InChIKey of methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate?
The InChIKey is PHPGLZARUZQNQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2O5S2/c1-17-6(14)5-7(18-4-11-5)19(15,16)12-2-8(9,10)3-13/h4,12-13H,2-3H2,1H3.
What are the key properties of methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate?
methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate has a molecular weight of 316.31 g/mol, XLogP of -0.16, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 104858746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).