About ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate
ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 104858876) has the molecular formula C9H13F2N3O5S
and a molecular weight of 313.28 g/mol. Its IUPAC name is ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
| PubChem CID | 104858876 |
| Molecular Formula | C9H13F2N3O5S |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C9H13F2N3O5S/c1-2-19-8(16)6-3-12-14-7(6)20(17,18)13-4-9(10,11)5-15/h3,13,15H,2,4-5H2,1H3,(H,12,14) |
| InChIKey | RYRIYBHCJIHBMF-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate?
The IUPAC name of ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate (CID 104858876) is ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate is CCOC(=O)c1cn[nH]c1S(=O)(=O)NCC(F)(F)CO.
What is the InChIKey of ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate?
The InChIKey is RYRIYBHCJIHBMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3O5S/c1-2-19-8(16)6-3-12-14-7(6)20(17,18)13-4-9(10,11)5-15/h3,13,15H,2,4-5H2,1H3,(H,12,14).
What are the key properties of ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate?
ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate has a molecular weight of 313.28 g/mol, XLogP of -0.51, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-1H-pyrazole-4-carboxylate is sourced from PubChem (CID 104858876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).