C8H14F3N3O2 — CID 104858914
1-[(4S)-4-methoxypyrrolidin-3-yl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 104858914) has the molecular formula C8H14F3N3O2 and a molecular weight of 241.21 g/mol. Its IUPAC name is 1-[(4S)-4-methoxypyrrolidin-3-yl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[(4S)-4-methoxypyrrolidin-3-yl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 104858914 |
| Molecular Formula | C8H14F3N3O2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 1-[(4S)-4-methoxypyrrolidin-3-yl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CO[C@H]1CNCC1NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O2/c1-16-6-3-12-2-5(6)14-7(15)13-4-8(9,10)11/h5-6,12H,2-4H2,1H3,(H2,13,14,15)/t5?,6-/m0/s1 |
| InChIKey | BTMFGJUBPHPJCW-GDVGLLTNSA-N |
| XLogP | -0.17 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |