C8H15F3N4O2 — CID 104858955
1-(4-amino-4-hydroxyiminobutan-2-yl)-1-methyl-3-(2,2,2-trifluoroethyl)urea (PubChem CID 104858955) has the molecular formula C8H15F3N4O2 and a molecular weight of 256.23 g/mol. Its IUPAC name is 1-(4-amino-4-hydroxyiminobutan-2-yl)-1-methyl-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(4-amino-4-hydroxyiminobutan-2-yl)-1-methyl-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 104858955 |
| Molecular Formula | C8H15F3N4O2 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-(4-amino-4-hydroxyiminobutan-2-yl)-1-methyl-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC(CC(N)=NO)N(C)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H15F3N4O2/c1-5(3-6(12)14-17)15(2)7(16)13-4-8(9,10)11/h5,17H,3-4H2,1-2H3,(H2,12,14)(H,13,16) |
| InChIKey | XNWVRMVKSOCYOY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|