About 1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine
1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine (PubChem CID 104858991) has the molecular formula C7H13F2N3O
and a molecular weight of 193.20 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine |
| PubChem CID | 104858991 |
| Molecular Formula | C7H13F2N3O |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine |
| SMILES | N/C(=N\CC(F)(F)CO)NC1CC1 |
| InChI | InChI=1S/C7H13F2N3O/c8-7(9,4-13)3-11-6(10)12-5-1-2-5/h5,13H,1-4H2,(H3,10,11,12) |
| InChIKey | WLHHBUQNWCBWGX-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine?
The IUPAC name of 1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine (CID 104858991) is 1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine.
What is the SMILES notation for 1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine?
The canonical SMILES for 1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine is N/C(=N\CC(F)(F)CO)NC1CC1.
What is the InChIKey of 1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine?
The InChIKey is WLHHBUQNWCBWGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F2N3O/c8-7(9,4-13)3-11-6(10)12-5-1-2-5/h5,13H,1-4H2,(H3,10,11,12).
What are the key properties of 1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine?
1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine has a molecular weight of 193.20 g/mol, XLogP of -0.32, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-(2,2-difluoro-3-hydroxypropyl)guanidine is sourced from PubChem (CID 104858991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).