About 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea
1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea (PubChem CID 104859004) has the molecular formula C11H19F3N2O
and a molecular weight of 252.28 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea |
| PubChem CID | 104859004 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea |
| SMILES | CC(CC(F)(F)F)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C11H19F3N2O/c1-8(7-11(12,13)14)15-10(17)16-9-5-3-2-4-6-9/h8-9H,2-7H2,1H3,(H2,15,16,17) |
| InChIKey | HSDXJHWQCCPLFV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea?
The IUPAC name of 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea (CID 104859004) is 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea.
What is the SMILES notation for 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea?
The canonical SMILES for 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea is CC(CC(F)(F)F)NC(=O)NC1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea?
The InChIKey is HSDXJHWQCCPLFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2O/c1-8(7-11(12,13)14)15-10(17)16-9-5-3-2-4-6-9/h8-9H,2-7H2,1H3,(H2,15,16,17).
What are the key properties of 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea?
1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea has a molecular weight of 252.28 g/mol, XLogP of 2.96, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)urea is sourced from PubChem (CID 104859004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).