C11H19F3N2S — CID 104859022
1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)thiourea (PubChem CID 104859022) has the molecular formula C11H19F3N2S and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)thiourea.
| Compound Name | 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)thiourea |
|---|---|
| PubChem CID | 104859022 |
| Molecular Formula | C11H19F3N2S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-cyclohexyl-3-(4,4,4-trifluorobutan-2-yl)thiourea |
| SMILES | CC(CC(F)(F)F)NC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C11H19F3N2S/c1-8(7-11(12,13)14)15-10(17)16-9-5-3-2-4-6-9/h8-9H,2-7H2,1H3,(H2,15,16,17) |
| InChIKey | AICRNPMVZXTWKG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|