C12H18N2O2S — CID 104859283
2-amino-N-[(1-methylcyclobutyl)methyl]benzenesulfonamide (PubChem CID 104859283) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 2-amino-N-[(1-methylcyclobutyl)methyl]benzenesulfonamide.
| Compound Name | 2-amino-N-[(1-methylcyclobutyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 104859283 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-amino-N-[(1-methylcyclobutyl)methyl]benzenesulfonamide |
| SMILES | CC1(CNS(=O)(=O)c2ccccc2N)CCC1 |
| InChI | InChI=1S/C12H18N2O2S/c1-12(7-4-8-12)9-14-17(15,16)11-6-3-2-5-10(11)13/h2-3,5-6,14H,4,7-9,13H2,1H3 |
| InChIKey | ZAXKRSOLAYKSBN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|