About 3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine
3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine (PubChem CID 104860312) has the molecular formula C10H18F3N
and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine.
Molecular Properties
| Compound Name | 3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine |
| PubChem CID | 104860312 |
| Molecular Formula | C10H18F3N |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine |
| SMILES | CC1CCC(NC(C)CC(F)(F)F)C1 |
| InChI | InChI=1S/C10H18F3N/c1-7-3-4-9(5-7)14-8(2)6-10(11,12)13/h7-9,14H,3-6H2,1-2H3 |
| InChIKey | ULHHZCQJXLBWKD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine?
The IUPAC name of 3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine (CID 104860312) is 3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine.
What is the SMILES notation for 3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine?
The canonical SMILES for 3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine is CC1CCC(NC(C)CC(F)(F)F)C1.
What is the InChIKey of 3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine?
The InChIKey is ULHHZCQJXLBWKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3N/c1-7-3-4-9(5-7)14-8(2)6-10(11,12)13/h7-9,14H,3-6H2,1-2H3.
What are the key properties of 3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine?
3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine has a molecular weight of 209.25 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-(4,4,4-trifluorobutan-2-yl)cyclopentan-1-amine is sourced from PubChem (CID 104860312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).