About 3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol
3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol (PubChem CID 104860446) has the molecular formula C11H19F2NO2
and a molecular weight of 235.27 g/mol. Its IUPAC name is 3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol.
Molecular Properties
| Compound Name | 3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol |
| PubChem CID | 104860446 |
| Molecular Formula | C11H19F2NO2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol |
| SMILES | CC1(C)C(NCC(F)(F)CO)C2CCOC21 |
| InChI | InChI=1S/C11H19F2NO2/c1-10(2)8(7-3-4-16-9(7)10)14-5-11(12,13)6-15/h7-9,14-15H,3-6H2,1-2H3 |
| InChIKey | RUIYDCAZLMYDOS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol?
The IUPAC name of 3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol (CID 104860446) is 3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol.
What is the SMILES notation for 3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol?
The canonical SMILES for 3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol is CC1(C)C(NCC(F)(F)CO)C2CCOC21.
What is the InChIKey of 3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol?
The InChIKey is RUIYDCAZLMYDOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F2NO2/c1-10(2)8(7-3-4-16-9(7)10)14-5-11(12,13)6-15/h7-9,14-15H,3-6H2,1-2H3.
What are the key properties of 3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol?
3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol has a molecular weight of 235.27 g/mol, XLogP of 1.02, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]-2,2-difluoropropan-1-ol is sourced from PubChem (CID 104860446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).