C14H17F2N3O — CID 104860544
2,2-difluoro-3-[1-(1-phenylpyrazol-4-yl)ethylamino]propan-1-ol (PubChem CID 104860544) has the molecular formula C14H17F2N3O and a molecular weight of 281.31 g/mol. Its IUPAC name is 2,2-difluoro-3-[1-(1-phenylpyrazol-4-yl)ethylamino]propan-1-ol.
| Compound Name | 2,2-difluoro-3-[1-(1-phenylpyrazol-4-yl)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 104860544 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2,2-difluoro-3-[1-(1-phenylpyrazol-4-yl)ethylamino]propan-1-ol |
| SMILES | CC(NCC(F)(F)CO)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H17F2N3O/c1-11(17-9-14(15,16)10-20)12-7-18-19(8-12)13-5-3-2-4-6-13/h2-8,11,17,20H,9-10H2,1H3 |
| InChIKey | YWTCEWKLFCPVPD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |